C9H8FNO3 — CID 117286568
3-fluoro-2-hydroxy-5,6-dimethoxybenzonitrile (PubChem CID 117286568) has the molecular formula C9H8FNO3 and a molecular weight of 197.16 g/mol. Its IUPAC name is 3-fluoro-2-hydroxy-5,6-dimethoxybenzonitrile.
| Compound Name | 3-fluoro-2-hydroxy-5,6-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 117286568 |
| Molecular Formula | C9H8FNO3 |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 3-fluoro-2-hydroxy-5,6-dimethoxybenzonitrile |
| SMILES | COc1cc(F)c(O)c(C#N)c1OC |
| InChI | InChI=1S/C9H8FNO3/c1-13-7-3-6(10)8(12)5(4-11)9(7)14-2/h3,12H,1-2H3 |
| InChIKey | DBOBLZBVSVEGNE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |