About 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol
1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol (PubChem CID 117290657) has the molecular formula C10H12F2O2
and a molecular weight of 202.20 g/mol. Its IUPAC name is 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol.
Molecular Properties
| Compound Name | 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol |
| PubChem CID | 117290657 |
| Molecular Formula | C10H12F2O2 |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol |
| SMILES | COCc1c(F)ccc(C(C)O)c1F |
| InChI | InChI=1S/C10H12F2O2/c1-6(13)7-3-4-9(11)8(5-14-2)10(7)12/h3-4,6,13H,5H2,1-2H3 |
| InChIKey | UFZZWSQMEBBPGS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol?
The IUPAC name of 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol (CID 117290657) is 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol.
What is the SMILES notation for 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol?
The canonical SMILES for 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol is COCc1c(F)ccc(C(C)O)c1F.
What is the InChIKey of 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol?
The InChIKey is UFZZWSQMEBBPGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2O2/c1-6(13)7-3-4-9(11)8(5-14-2)10(7)12/h3-4,6,13H,5H2,1-2H3.
What are the key properties of 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol?
1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol has a molecular weight of 202.20 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,4-difluoro-3-(methoxymethyl)phenyl]ethanol is sourced from PubChem (CID 117290657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).