C12H17N3 — CID 117291997
2-[3-(4,5-dihydroimidazol-1-yl)phenyl]propan-2-amine (PubChem CID 117291997) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-[3-(4,5-dihydroimidazol-1-yl)phenyl]propan-2-amine.
| Compound Name | 2-[3-(4,5-dihydroimidazol-1-yl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 117291997 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-[3-(4,5-dihydroimidazol-1-yl)phenyl]propan-2-amine |
| SMILES | CC(C)(N)c1cccc(N2C=NCC2)c1 |
| InChI | InChI=1S/C12H17N3/c1-12(2,13)10-4-3-5-11(8-10)15-7-6-14-9-15/h3-5,8-9H,6-7,13H2,1-2H3 |
| InChIKey | HCSAUIWTLWMNHY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |