C12H14N2O — CID 117290888
3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal (PubChem CID 117290888) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal.
| Compound Name | 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal |
|---|---|
| PubChem CID | 117290888 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal |
| SMILES | O=CCCc1cccc(N2C=NCC2)c1 |
| InChI | InChI=1S/C12H14N2O/c15-8-2-4-11-3-1-5-12(9-11)14-7-6-13-10-14/h1,3,5,8-10H,2,4,6-7H2 |
| InChIKey | UDCWGNKYRAOJOV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|