About 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal
3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal (PubChem CID 117290888) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal.
Molecular Properties
| Compound Name | 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal |
| PubChem CID | 117290888 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal |
| SMILES | O=CCCc1cccc(N2C=NCC2)c1 |
| InChI | InChI=1S/C12H14N2O/c15-8-2-4-11-3-1-5-12(9-11)14-7-6-13-10-14/h1,3,5,8-10H,2,4,6-7H2 |
| InChIKey | UDCWGNKYRAOJOV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal?
The IUPAC name of 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal (CID 117290888) is 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal.
What is the SMILES notation for 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal?
The canonical SMILES for 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal is O=CCCc1cccc(N2C=NCC2)c1.
What is the InChIKey of 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal?
The InChIKey is UDCWGNKYRAOJOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c15-8-2-4-11-3-1-5-12(9-11)14-7-6-13-10-14/h1,3,5,8-10H,2,4,6-7H2.
What are the key properties of 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal?
3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal has a molecular weight of 202.26 g/mol, XLogP of 1.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4,5-dihydroimidazol-1-yl)phenyl]propanal is sourced from PubChem (CID 117290888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).