About 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole
1-(2,6-dipropylphenyl)-4,5-dihydroimidazole (PubChem CID 151094163) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole |
| PubChem CID | 151094163 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole |
| SMILES | CCCc1cccc(CCC)c1N1C=NCC1 |
| InChI | InChI=1S/C15H22N2/c1-3-6-13-8-5-9-14(7-4-2)15(13)17-11-10-16-12-17/h5,8-9,12H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | MMTCTQBMTPPPMX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole?
The IUPAC name of 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole (CID 151094163) is 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole.
What is the SMILES notation for 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole?
The canonical SMILES for 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole is CCCc1cccc(CCC)c1N1C=NCC1.
What is the InChIKey of 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole?
The InChIKey is MMTCTQBMTPPPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2/c1-3-6-13-8-5-9-14(7-4-2)15(13)17-11-10-16-12-17/h5,8-9,12H,3-4,6-7,10-11H2,1-2H3.
What are the key properties of 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole?
1-(2,6-dipropylphenyl)-4,5-dihydroimidazole has a molecular weight of 230.35 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole is sourced from PubChem (CID 151094163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).