C15H22N2 — CID 151094163
1-(2,6-dipropylphenyl)-4,5-dihydroimidazole (PubChem CID 151094163) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole.
| Compound Name | 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 151094163 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-(2,6-dipropylphenyl)-4,5-dihydroimidazole |
| SMILES | CCCc1cccc(CCC)c1N1C=NCC1 |
| InChI | InChI=1S/C15H22N2/c1-3-6-13-8-5-9-14(7-4-2)15(13)17-11-10-16-12-17/h5,8-9,12H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | MMTCTQBMTPPPMX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |