C14H16N2O3 — CID 117404708
3-[3-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]propanal (PubChem CID 117404708) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-[3-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]propanal.
| Compound Name | 3-[3-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]propanal |
|---|---|
| PubChem CID | 117404708 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-[3-(4-methyl-2,3-dioxopiperazin-1-yl)phenyl]propanal |
| SMILES | CN1CCN(c2cccc(CCC=O)c2)C(=O)C1=O |
| InChI | InChI=1S/C14H16N2O3/c1-15-7-8-16(14(19)13(15)18)12-6-2-4-11(10-12)5-3-9-17/h2,4,6,9-10H,3,5,7-8H2,1H3 |
| InChIKey | KLLXPIYBAPUHKE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|