C14H16N2O3 — CID 117404686
1-methyl-4-[3-(2-oxopropyl)phenyl]piperazine-2,3-dione (PubChem CID 117404686) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-methyl-4-[3-(2-oxopropyl)phenyl]piperazine-2,3-dione.
| Compound Name | 1-methyl-4-[3-(2-oxopropyl)phenyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 117404686 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-methyl-4-[3-(2-oxopropyl)phenyl]piperazine-2,3-dione |
| SMILES | CC(=O)Cc1cccc(N2CCN(C)C(=O)C2=O)c1 |
| InChI | InChI=1S/C14H16N2O3/c1-10(17)8-11-4-3-5-12(9-11)16-7-6-15(2)13(18)14(16)19/h3-5,9H,6-8H2,1-2H3 |
| InChIKey | NQOXGPTUSKIQPS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|