C22H32O8 — CID 11729561
[(2S)-2-hydroxy-2-[(4R,5R)-5-(methoxymethoxy)-2-phenyl-1,3-dioxan-4-yl]ethyl] 3-oxooctanoate (PubChem CID 11729561) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[(4R,5R)-5-(methoxymethoxy)-2-phenyl-1,3-dioxan-4-yl]ethyl] 3-oxooctanoate.
| Compound Name | [(2S)-2-hydroxy-2-[(4R,5R)-5-(methoxymethoxy)-2-phenyl-1,3-dioxan-4-yl]ethyl] 3-oxooctanoate |
|---|---|
| PubChem CID | 11729561 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(2S)-2-hydroxy-2-[(4R,5R)-5-(methoxymethoxy)-2-phenyl-1,3-dioxan-4-yl]ethyl] 3-oxooctanoate |
| SMILES | CCCCCC(=O)CC(=O)OC[C@H](O)[C@H]1OC(c2ccccc2)OC[C@H]1OCOC |
| InChI | InChI=1S/C22H32O8/c1-3-4-6-11-17(23)12-20(25)27-13-18(24)21-19(29-15-26-2)14-28-22(30-21)16-9-7-5-8-10-16/h5,7-10,18-19,21-22,24H,3-4,6,11-15H2,1-2H3/t18-,19+,21+,22?/m0/s1 |
| InChIKey | DUOOQANOVUDKBY-RERQMSIWSA-N |
| XLogP | 2.53 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|