C24H18N2O6 — CID 11729673
(1S,7R,13S,19R)-10,22-dimethyl-25,26-dioxa-10,22-diazaoctacyclo[17.5.1.17,13.02,18.03,15.06,14.08,12.020,24]hexacosa-2(18),3(15),4,6(14),16-pentaene-9,11,21,23-tetrone (PubChem CID 11729673) has the molecular formula C24H18N2O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is (1S,7R,13S,19R)-10,22-dimethyl-25,26-dioxa-10,22-diazaoctacyclo[17.5.1.17,13.02,18.03,15.06,14.08,12.020,24]hexacosa-2(18),3(15),4,6(14),16-pentaene-9,11,21,23-tetrone.
| Compound Name | (1S,7R,13S,19R)-10,22-dimethyl-25,26-dioxa-10,22-diazaoctacyclo[17.5.1.17,13.02,18.03,15.06,14.08,12.020,24]hexacosa-2(18),3(15),4,6(14),16-pentaene-9,11,21,23-tetrone |
|---|---|
| PubChem CID | 11729673 |
| Molecular Formula | C24H18N2O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (1S,7R,13S,19R)-10,22-dimethyl-25,26-dioxa-10,22-diazaoctacyclo[17.5.1.17,13.02,18.03,15.06,14.08,12.020,24]hexacosa-2(18),3(15),4,6(14),16-pentaene-9,11,21,23-tetrone |
| SMILES | CN1C(=O)C2C(C1=O)[C@H]1O[C@@H]2c2c1ccc1c3c(ccc21)[C@@H]1O[C@H]3C2C(=O)N(C)C(=O)C21 |
| InChI | InChI=1S/C24H18N2O6/c1-25-21(27)13-15(23(25)29)19-11-7-4-6-10-12(8(7)3-5-9(11)17(13)31-19)20-16-14(18(10)32-20)22(28)26(2)24(16)30/h3-6,13-20H,1-2H3/t13?,14?,15?,16?,17-,18-,19+,20+/m0/s1 |
| InChIKey | DVPJVSSPAGAUAZ-IDMXJFQASA-N |
| XLogP | 1.55 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|