C21H15NO3 — CID 15535088
(1R,16S,17R,21S)-19-methyl-22-oxa-19-azahexacyclo[14.5.1.02,15.04,13.05,10.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20-dione (PubChem CID 15535088) has the molecular formula C21H15NO3 and a molecular weight of 329.36 g/mol. Its IUPAC name is (1R,16S,17R,21S)-19-methyl-22-oxa-19-azahexacyclo[14.5.1.02,15.04,13.05,10.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20-dione.
| Compound Name | (1R,16S,17R,21S)-19-methyl-22-oxa-19-azahexacyclo[14.5.1.02,15.04,13.05,10.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20-dione |
|---|---|
| PubChem CID | 15535088 |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (1R,16S,17R,21S)-19-methyl-22-oxa-19-azahexacyclo[14.5.1.02,15.04,13.05,10.017,21]docosa-2(15),3,5,7,9,11,13-heptaene-18,20-dione |
| SMILES | CN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1O[C@@H]2c2cc3ccc4ccccc4c3cc21 |
| InChI | InChI=1S/C21H15NO3/c1-22-20(23)16-17(21(22)24)19-15-9-13-11(8-14(15)18(16)25-19)7-6-10-4-2-3-5-12(10)13/h2-9,16-19H,1H3/t16-,17+,18-,19+/m1/s1 |
| InChIKey | MIMASLHUFNIVKN-HCXYKTFWSA-N |
| XLogP | 3.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|