C15H16NO6P — CID 102153886
1-dimethoxyphosphoryl-11-methyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 102153886) has the molecular formula C15H16NO6P and a molecular weight of 337.27 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-11-methyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | 1-dimethoxyphosphoryl-11-methyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 102153886 |
| Molecular Formula | C15H16NO6P |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-dimethoxyphosphoryl-11-methyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | COP(=O)(OC)C12OC(c3ccccc31)C1C(=O)N(C)C(=O)C12 |
| InChI | InChI=1S/C15H16NO6P/c1-16-13(17)10-11(14(16)18)15(23(19,20-2)21-3)9-7-5-4-6-8(9)12(10)22-15/h4-7,10-12H,1-3H3 |
| InChIKey | WIACKVJTGJZXNQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|