C15H13NO5 — CID 134907327
[(1R,8R,9S,13R)-11-methyl-10,12-dioxo-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-trien-1-yl] acetate (PubChem CID 134907327) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is [(1R,8R,9S,13R)-11-methyl-10,12-dioxo-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-trien-1-yl] acetate.
| Compound Name | [(1R,8R,9S,13R)-11-methyl-10,12-dioxo-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-trien-1-yl] acetate |
|---|---|
| PubChem CID | 134907327 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | [(1R,8R,9S,13R)-11-methyl-10,12-dioxo-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-trien-1-yl] acetate |
| SMILES | CC(=O)O[C@@]12O[C@@H](c3ccccc31)[C@H]1C(=O)N(C)C(=O)[C@H]12 |
| InChI | InChI=1S/C15H13NO5/c1-7(17)20-15-9-6-4-3-5-8(9)12(21-15)10-11(15)14(19)16(2)13(10)18/h3-6,10-12H,1-2H3/t10-,11-,12-,15+/m0/s1 |
| InChIKey | JPUYAHDIIZDQJM-JUFZMCDQSA-N |
| XLogP | 0.72 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|