C17H21NO4Si — CID 135051392
(1S,8S,9R,13R)-1-methoxy-11-methyl-8-trimethylsilyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 135051392) has the molecular formula C17H21NO4Si and a molecular weight of 331.44 g/mol. Its IUPAC name is (1S,8S,9R,13R)-1-methoxy-11-methyl-8-trimethylsilyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | (1S,8S,9R,13R)-1-methoxy-11-methyl-8-trimethylsilyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 135051392 |
| Molecular Formula | C17H21NO4Si |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (1S,8S,9R,13R)-1-methoxy-11-methyl-8-trimethylsilyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | CO[C@@]12O[C@@]([Si](C)(C)C)(c3ccccc31)[C@H]1C(=O)N(C)C(=O)[C@H]12 |
| InChI | InChI=1S/C17H21NO4Si/c1-18-14(19)12-13(15(18)20)17(23(3,4)5)11-9-7-6-8-10(11)16(12,21-2)22-17/h6-9,12-13H,1-5H3/t12-,13+,16+,17+/m0/s1 |
| InChIKey | BLIDVKFEYQJXSJ-NSNWQYSKSA-N |
| XLogP | 1.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|