C22H23NO3Si — CID 138971809
(1S,8R,9S,13S)-11-methyl-1-phenyl-8-trimethylsilyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 138971809) has the molecular formula C22H23NO3Si and a molecular weight of 377.52 g/mol. Its IUPAC name is (1S,8R,9S,13S)-11-methyl-1-phenyl-8-trimethylsilyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | (1S,8R,9S,13S)-11-methyl-1-phenyl-8-trimethylsilyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 138971809 |
| Molecular Formula | C22H23NO3Si |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (1S,8R,9S,13S)-11-methyl-1-phenyl-8-trimethylsilyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | CN1C(=O)[C@@H]2[C@H](C1=O)[C@@]1(c3ccccc3)O[C@]2([Si](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C22H23NO3Si/c1-23-19(24)17-18(20(23)25)22(27(2,3)4)16-13-9-8-12-15(16)21(17,26-22)14-10-6-5-7-11-14/h5-13,17-18H,1-4H3/t17-,18+,21+,22+/m1/s1 |
| InChIKey | ZOTIZOLARLKPRF-KSCDAYEDSA-N |
| XLogP | 3.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|