C25H19NO3 — CID 138973650
(1R,8S)-11-methyl-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 138973650) has the molecular formula C25H19NO3 and a molecular weight of 381.43 g/mol. Its IUPAC name is (1R,8S)-11-methyl-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | (1R,8S)-11-methyl-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 138973650 |
| Molecular Formula | C25H19NO3 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (1R,8S)-11-methyl-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | CN1C(=O)C2C(C1=O)[C@@]1(c3ccccc3)O[C@]2(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H19NO3/c1-26-22(27)20-21(23(26)28)25(17-12-6-3-7-13-17)19-15-9-8-14-18(19)24(20,29-25)16-10-4-2-5-11-16/h2-15,20-21H,1H3/t20?,21?,24-,25+ |
| InChIKey | HLLYVYNEAGUZJG-SDAXMRTPSA-N |
| XLogP | 3.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|