C11H16N2O2 — CID 117297783
6-(aminooxymethyl)-1-methyl-3,4-dihydro-2H-quinolin-5-ol (PubChem CID 117297783) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 6-(aminooxymethyl)-1-methyl-3,4-dihydro-2H-quinolin-5-ol.
| Compound Name | 6-(aminooxymethyl)-1-methyl-3,4-dihydro-2H-quinolin-5-ol |
|---|---|
| PubChem CID | 117297783 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 6-(aminooxymethyl)-1-methyl-3,4-dihydro-2H-quinolin-5-ol |
| SMILES | CN1CCCc2c1ccc(CON)c2O |
| InChI | InChI=1S/C11H16N2O2/c1-13-6-2-3-9-10(13)5-4-8(7-15-12)11(9)14/h4-5,14H,2-3,6-7,12H2,1H3 |
| InChIKey | ZGUNJWOVXYLTAJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|