About 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal
3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal (PubChem CID 117338481) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal.
Molecular Properties
| Compound Name | 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal |
| PubChem CID | 117338481 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal |
| SMILES | CC(CC=O)c1ccc2c(c1O)CCCN2C |
| InChI | InChI=1S/C14H19NO2/c1-10(7-9-16)11-5-6-13-12(14(11)17)4-3-8-15(13)2/h5-6,9-10,17H,3-4,7-8H2,1-2H3 |
| InChIKey | KPQFONMTRUHLMQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal?
The IUPAC name of 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal (CID 117338481) is 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal.
What is the SMILES notation for 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal?
The canonical SMILES for 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal is CC(CC=O)c1ccc2c(c1O)CCCN2C.
What is the InChIKey of 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal?
The InChIKey is KPQFONMTRUHLMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-10(7-9-16)11-5-6-13-12(14(11)17)4-3-8-15(13)2/h5-6,9-10,17H,3-4,7-8H2,1-2H3.
What are the key properties of 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal?
3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal has a molecular weight of 233.31 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)butanal is sourced from PubChem (CID 117338481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).