C22H44OSn — CID 11729936
tributyl-[[(1R)-2,4,4-trimethylcyclohex-2-en-1-yl]oxymethyl]stannane (PubChem CID 11729936) has the molecular formula C22H44OSn and a molecular weight of 443.30 g/mol. Its IUPAC name is tributyl-[[(1R)-2,4,4-trimethylcyclohex-2-en-1-yl]oxymethyl]stannane.
| Compound Name | tributyl-[[(1R)-2,4,4-trimethylcyclohex-2-en-1-yl]oxymethyl]stannane |
|---|---|
| PubChem CID | 11729936 |
| Molecular Formula | C22H44OSn |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | tributyl-[[(1R)-2,4,4-trimethylcyclohex-2-en-1-yl]oxymethyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)CO[C@@H]1CCC(C)(C)C=C1C |
| InChI | InChI=1S/C10H17O.3C4H9.Sn/c1-8-7-10(2,3)6-5-9(8)11-4;3*1-3-4-2;/h7,9H,4-6H2,1-3H3;3*1,3-4H2,2H3;/t9-;;;;/m1..../s1 |
| InChIKey | JFQVMLLJIRXDLR-RASHCQHBSA-N |
| XLogP | 7.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|