C20H29BrO6 — CID 11729981
[(2S,4R)-2-[(1S)-1-acetyloxyheptyl]-8-bromo-5-oxo-2,3,4,6,7,8-hexahydrochromen-4-yl] acetate (PubChem CID 11729981) has the molecular formula C20H29BrO6 and a molecular weight of 445.35 g/mol. Its IUPAC name is [(2S,4R)-2-[(1S)-1-acetyloxyheptyl]-8-bromo-5-oxo-2,3,4,6,7,8-hexahydrochromen-4-yl] acetate.
| Compound Name | [(2S,4R)-2-[(1S)-1-acetyloxyheptyl]-8-bromo-5-oxo-2,3,4,6,7,8-hexahydrochromen-4-yl] acetate |
|---|---|
| PubChem CID | 11729981 |
| Molecular Formula | C20H29BrO6 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [(2S,4R)-2-[(1S)-1-acetyloxyheptyl]-8-bromo-5-oxo-2,3,4,6,7,8-hexahydrochromen-4-yl] acetate |
| SMILES | CCCCCC[C@H](OC(C)=O)[C@@H]1C[C@@H](OC(C)=O)C2=C(O1)C(Br)CCC2=O |
| InChI | InChI=1S/C20H29BrO6/c1-4-5-6-7-8-16(25-12(2)22)17-11-18(26-13(3)23)19-15(24)10-9-14(21)20(19)27-17/h14,16-18H,4-11H2,1-3H3/t14?,16-,17-,18+/m0/s1 |
| InChIKey | ZQTPLPVNYDPGDG-ASDXVTRWSA-N |
| XLogP | 3.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|