C20H30O6 — CID 11245530
[(2S,8R)-2-[(1S)-1-acetyloxyheptyl]-5-oxo-2,3,4,6,7,8-hexahydrochromen-8-yl] acetate (PubChem CID 11245530) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is [(2S,8R)-2-[(1S)-1-acetyloxyheptyl]-5-oxo-2,3,4,6,7,8-hexahydrochromen-8-yl] acetate.
| Compound Name | [(2S,8R)-2-[(1S)-1-acetyloxyheptyl]-5-oxo-2,3,4,6,7,8-hexahydrochromen-8-yl] acetate |
|---|---|
| PubChem CID | 11245530 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [(2S,8R)-2-[(1S)-1-acetyloxyheptyl]-5-oxo-2,3,4,6,7,8-hexahydrochromen-8-yl] acetate |
| SMILES | CCCCCC[C@H](OC(C)=O)[C@@H]1CCC2=C(O1)[C@H](OC(C)=O)CCC2=O |
| InChI | InChI=1S/C20H30O6/c1-4-5-6-7-8-17(24-13(2)21)18-11-9-15-16(23)10-12-19(20(15)26-18)25-14(3)22/h17-19H,4-12H2,1-3H3/t17-,18-,19+/m0/s1 |
| InChIKey | VHFSMUUDRAOURA-GBESFXJTSA-N |
| XLogP | 3.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|