C22H32O7 — CID 139585552
[(1S)-2-acetyloxy-3-[(E)-4-acetyloxydec-2-enyl]-4-oxocyclohex-2-en-1-yl] acetate (PubChem CID 139585552) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(1S)-2-acetyloxy-3-[(E)-4-acetyloxydec-2-enyl]-4-oxocyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S)-2-acetyloxy-3-[(E)-4-acetyloxydec-2-enyl]-4-oxocyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 139585552 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [(1S)-2-acetyloxy-3-[(E)-4-acetyloxydec-2-enyl]-4-oxocyclohex-2-en-1-yl] acetate |
| SMILES | CCCCCCC(/C=C/CC1=C(OC(C)=O)[C@@H](OC(C)=O)CCC1=O)OC(C)=O |
| InChI | InChI=1S/C22H32O7/c1-5-6-7-8-10-18(27-15(2)23)11-9-12-19-20(26)13-14-21(28-16(3)24)22(19)29-17(4)25/h9,11,18,21H,5-8,10,12-14H2,1-4H3/b11-9+/t18?,21-/m0/s1 |
| InChIKey | CMNJPOQNZUMCPC-LLXGPOICSA-N |
| XLogP | 3.95 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|