C18H28O4 — CID 10913870
[(1S)-1-[(2S)-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate (PubChem CID 10913870) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is [(1S)-1-[(2S)-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate.
| Compound Name | [(1S)-1-[(2S)-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate |
|---|---|
| PubChem CID | 10913870 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | [(1S)-1-[(2S)-5-oxo-2,3,4,6,7,8-hexahydrochromen-2-yl]heptyl] acetate |
| SMILES | CCCCCC[C@H](OC(C)=O)[C@@H]1CCC2=C(CCCC2=O)O1 |
| InChI | InChI=1S/C18H28O4/c1-3-4-5-6-9-17(21-13(2)19)18-12-11-14-15(20)8-7-10-16(14)22-18/h17-18H,3-12H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | NIIVUPKBUJKFAD-ROUUACIJSA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|