C13H15NO2 — CID 117309392
3-[4-(4-methyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]propanal (PubChem CID 117309392) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-[4-(4-methyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]propanal.
| Compound Name | 3-[4-(4-methyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]propanal |
|---|---|
| PubChem CID | 117309392 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-[4-(4-methyl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]propanal |
| SMILES | CC1COC(c2ccc(CCC=O)cc2)=N1 |
| InChI | InChI=1S/C13H15NO2/c1-10-9-16-13(14-10)12-6-4-11(5-7-12)3-2-8-15/h4-8,10H,2-3,9H2,1H3 |
| InChIKey | GYEOPWYZWIPISJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|