C22H26N4O4 — CID 102128598
(4R)-4-methyl-2-[2,4,5-tris[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 102128598) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is (4R)-4-methyl-2-[2,4,5-tris[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-4-methyl-2-[2,4,5-tris[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102128598 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (4R)-4-methyl-2-[2,4,5-tris[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | C[C@@H]1COC(c2cc(C3=N[C@H](C)CO3)c(C3=N[C@H](C)CO3)cc2C2=N[C@H](C)CO2)=N1 |
| InChI | InChI=1S/C22H26N4O4/c1-11-7-27-19(23-11)15-5-17(21-25-13(3)9-29-21)18(22-26-14(4)10-30-22)6-16(15)20-24-12(2)8-28-20/h5-6,11-14H,7-10H2,1-4H3/t11-,12-,13-,14-/m1/s1 |
| InChIKey | LJQXRQFYNYJZTB-AAVRWANBSA-N |
| XLogP | 2.35 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |