C23H27N2O2P — CID 102387210
bis[2-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-propan-2-ylphosphane (PubChem CID 102387210) has the molecular formula C23H27N2O2P and a molecular weight of 394.46 g/mol. Its IUPAC name is bis[2-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-propan-2-ylphosphane.
| Compound Name | bis[2-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-propan-2-ylphosphane |
|---|---|
| PubChem CID | 102387210 |
| Molecular Formula | C23H27N2O2P |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | bis[2-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-propan-2-ylphosphane |
| SMILES | CC(C)P(c1ccccc1C1=N[C@@H](C)CO1)c1ccccc1C1=N[C@@H](C)CO1 |
| InChI | InChI=1S/C23H27N2O2P/c1-15(2)28(20-11-7-5-9-18(20)22-24-16(3)13-26-22)21-12-8-6-10-19(21)23-25-17(4)14-27-23/h5-12,15-17H,13-14H2,1-4H3/t16-,17-/m0/s1 |
| InChIKey | QHVYZUAXJNKSQG-IRXDYDNUSA-N |
| XLogP | 3.86 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|