C12H16NOP — CID 59093598
dimethyl-[2-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane (PubChem CID 59093598) has the molecular formula C12H16NOP and a molecular weight of 221.24 g/mol. Its IUPAC name is dimethyl-[2-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane.
| Compound Name | dimethyl-[2-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 59093598 |
| Molecular Formula | C12H16NOP |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | dimethyl-[2-[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane |
| SMILES | C[C@H]1COC(c2ccccc2P(C)C)=N1 |
| InChI | InChI=1S/C12H16NOP/c1-9-8-14-12(13-9)10-6-4-5-7-11(10)15(2)3/h4-7,9H,8H2,1-3H3/t9-/m0/s1 |
| InChIKey | UUSNGJLBKYJRLB-VIFPVBQESA-N |
| XLogP | 2.22 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|