C39H39N3O3 — CID 102331832
(4S)-2-[3,5-bis[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]-2,4,6-tris(4-methylphenyl)phenyl]-4-methyl-4,5-dihydro-1,3-oxazole (PubChem CID 102331832) has the molecular formula C39H39N3O3 and a molecular weight of 597.76 g/mol. Its IUPAC name is (4S)-2-[3,5-bis[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]-2,4,6-tris(4-methylphenyl)phenyl]-4-methyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[3,5-bis[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]-2,4,6-tris(4-methylphenyl)phenyl]-4-methyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102331832 |
| Molecular Formula | C39H39N3O3 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | (4S)-2-[3,5-bis[(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]-2,4,6-tris(4-methylphenyl)phenyl]-4-methyl-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1ccc(-c2c(C3=N[C@@H](C)CO3)c(-c3ccc(C)cc3)c(C3=N[C@@H](C)CO3)c(-c3ccc(C)cc3)c2C2=N[C@@H](C)CO2)cc1 |
| InChI | InChI=1S/C39H39N3O3/c1-22-7-13-28(14-8-22)31-34(37-40-25(4)19-43-37)32(29-15-9-23(2)10-16-29)36(39-42-27(6)21-45-39)33(30-17-11-24(3)12-18-30)35(31)38-41-26(5)20-44-38/h7-18,25-27H,19-21H2,1-6H3/t25-,26-,27-/m0/s1 |
| InChIKey | WDMVFVZFDJSEMG-QKDODKLFSA-N |
| XLogP | 8.11 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |