C14H17NO — CID 175229268
2-(4-pent-3-enylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 175229268) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-(4-pent-3-enylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(4-pent-3-enylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 175229268 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-(4-pent-3-enylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC=CCCc1ccc(C2=NCCO2)cc1 |
| InChI | InChI=1S/C14H17NO/c1-2-3-4-5-12-6-8-13(9-7-12)14-15-10-11-16-14/h2-3,6-9H,4-5,10-11H2,1H3 |
| InChIKey | QCGDWARJHQXDRT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|