C15H21NO — CID 132519397
2-(4-hexylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 132519397) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-(4-hexylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(4-hexylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 132519397 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-(4-hexylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCc1ccc(C2=NCCO2)cc1 |
| InChI | InChI=1S/C15H21NO/c1-2-3-4-5-6-13-7-9-14(10-8-13)15-16-11-12-17-15/h7-10H,2-6,11-12H2,1H3 |
| InChIKey | PAXWOJQMPNYOAQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|