C11H14N4O — CID 117311096
1-(2-aminoquinoxalin-6-yl)-2-(methylamino)ethanol (PubChem CID 117311096) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-(2-aminoquinoxalin-6-yl)-2-(methylamino)ethanol.
| Compound Name | 1-(2-aminoquinoxalin-6-yl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 117311096 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-(2-aminoquinoxalin-6-yl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1ccc2nc(N)cnc2c1 |
| InChI | InChI=1S/C11H14N4O/c1-13-5-10(16)7-2-3-8-9(4-7)14-6-11(12)15-8/h2-4,6,10,13,16H,5H2,1H3,(H2,12,15) |
| InChIKey | ZJDPDHIKHZPDRY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |