C10H9N3O3 — CID 117311798
5-(5-amino-1H-pyrazol-4-yl)-1,3-benzodioxol-4-ol (PubChem CID 117311798) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 5-(5-amino-1H-pyrazol-4-yl)-1,3-benzodioxol-4-ol.
| Compound Name | 5-(5-amino-1H-pyrazol-4-yl)-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 117311798 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 5-(5-amino-1H-pyrazol-4-yl)-1,3-benzodioxol-4-ol |
| SMILES | Nc1[nH]ncc1-c1ccc2c(c1O)OCO2 |
| InChI | InChI=1S/C10H9N3O3/c11-10-6(3-12-13-10)5-1-2-7-9(8(5)14)16-4-15-7/h1-3,14H,4H2,(H3,11,12,13) |
| InChIKey | VRGZUQXXJOOBBN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |