C11H11N3O4S — CID 117451305
4-(4-methylsulfonyl-1,3-benzodioxol-5-yl)-1H-pyrazol-5-amine (PubChem CID 117451305) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is 4-(4-methylsulfonyl-1,3-benzodioxol-5-yl)-1H-pyrazol-5-amine.
| Compound Name | 4-(4-methylsulfonyl-1,3-benzodioxol-5-yl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117451305 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 4-(4-methylsulfonyl-1,3-benzodioxol-5-yl)-1H-pyrazol-5-amine |
| SMILES | CS(=O)(=O)c1c(-c2cn[nH]c2N)ccc2c1OCO2 |
| InChI | InChI=1S/C11H11N3O4S/c1-19(15,16)10-6(7-4-13-14-11(7)12)2-3-8-9(10)18-5-17-8/h2-4H,5H2,1H3,(H3,12,13,14) |
| InChIKey | RCGNWBRKKQJTGF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |