C13H14FNO — CID 117312317
[1-(4-fluoro-1-benzofuran-5-yl)cyclobutyl]methanamine (PubChem CID 117312317) has the molecular formula C13H14FNO and a molecular weight of 219.26 g/mol. Its IUPAC name is [1-(4-fluoro-1-benzofuran-5-yl)cyclobutyl]methanamine.
| Compound Name | [1-(4-fluoro-1-benzofuran-5-yl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 117312317 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | [1-(4-fluoro-1-benzofuran-5-yl)cyclobutyl]methanamine |
| SMILES | NCC1(c2ccc3occc3c2F)CCC1 |
| InChI | InChI=1S/C13H14FNO/c14-12-9-4-7-16-11(9)3-2-10(12)13(8-15)5-1-6-13/h2-4,7H,1,5-6,8,15H2 |
| InChIKey | UZXSAHFAQLPWQR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |