C13H17NO2 — CID 117312539
1-(isocyanatomethyl)-3,4-dimethyl-2-propan-2-yloxybenzene (PubChem CID 117312539) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-(isocyanatomethyl)-3,4-dimethyl-2-propan-2-yloxybenzene.
| Compound Name | 1-(isocyanatomethyl)-3,4-dimethyl-2-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 117312539 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-(isocyanatomethyl)-3,4-dimethyl-2-propan-2-yloxybenzene |
| SMILES | Cc1ccc(CN=C=O)c(OC(C)C)c1C |
| InChI | InChI=1S/C13H17NO2/c1-9(2)16-13-11(4)10(3)5-6-12(13)7-14-8-15/h5-6,9H,7H2,1-4H3 |
| InChIKey | JPUKHTLRVUARNH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|