C33H32F3NO3 — CID 11731307
methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]methyl]amino]phenyl]prop-2-enoate (PubChem CID 11731307) has the molecular formula C33H32F3NO3 and a molecular weight of 547.62 g/mol. Its IUPAC name is methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11731307 |
| Molecular Formula | C33H32F3NO3 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc(/C=C/c3cccc(C(F)(F)F)c3)cc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C33H32F3NO3/c1-40-31(38)20-19-26-8-6-12-30(22-26)37(32(39)28-9-3-2-4-10-28)23-27-17-14-24(15-18-27)13-16-25-7-5-11-29(21-25)33(34,35)36/h5-8,11-22,28H,2-4,9-10,23H2,1H3/b16-13+,20-19+ |
| InChIKey | MFVZXXIGIRQNQR-ZMUVCXEASA-N |
| XLogP | 8.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|