C32H31F2NO3 — CID 10951379
methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenyl]methyl]amino]phenyl]prop-2-enoate (PubChem CID 10951379) has the molecular formula C32H31F2NO3 and a molecular weight of 515.60 g/mol. Its IUPAC name is methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenyl]methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 10951379 |
| Molecular Formula | C32H31F2NO3 |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-[(E)-2-(2,6-difluorophenyl)ethenyl]phenyl]methyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc(/C=C/c3c(F)cccc3F)cc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C32H31F2NO3/c1-38-31(36)20-18-24-7-5-10-27(21-24)35(32(37)26-8-3-2-4-9-26)22-25-15-13-23(14-16-25)17-19-28-29(33)11-6-12-30(28)34/h5-7,10-21,26H,2-4,8-9,22H2,1H3/b19-17+,20-18+ |
| InChIKey | AXDFJAOZQWJYSJ-XPWSMXQVSA-N |
| XLogP | 7.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|