C31H32FNO5S — CID 126717023
methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-(3-fluoro-4-methylsulfonylphenyl)phenyl]methyl]amino]phenyl]prop-2-enoate (PubChem CID 126717023) has the molecular formula C31H32FNO5S and a molecular weight of 549.66 g/mol. Its IUPAC name is methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-(3-fluoro-4-methylsulfonylphenyl)phenyl]methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-(3-fluoro-4-methylsulfonylphenyl)phenyl]methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 126717023 |
| Molecular Formula | C31H32FNO5S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-(3-fluoro-4-methylsulfonylphenyl)phenyl]methyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc(-c3ccc(S(C)(=O)=O)c(F)c3)cc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C31H32FNO5S/c1-38-30(34)18-13-22-7-6-10-27(19-22)33(31(35)25-8-4-3-5-9-25)21-23-11-14-24(15-12-23)26-16-17-29(28(32)20-26)39(2,36)37/h6-7,10-20,25H,3-5,8-9,21H2,1-2H3/b18-13+ |
| InChIKey | SSGHLIDJQKGEPB-QGOAFFKASA-N |
| XLogP | 6.20 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|