C31H31N3O3 — CID 126717080
methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-(1H-indazol-5-yl)phenyl]methyl]amino]phenyl]prop-2-enoate (PubChem CID 126717080) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-(1H-indazol-5-yl)phenyl]methyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-(1H-indazol-5-yl)phenyl]methyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 126717080 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | methyl (E)-3-[3-[cyclohexanecarbonyl-[[4-(1H-indazol-5-yl)phenyl]methyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc(-c3ccc4[nH]ncc4c3)cc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C31H31N3O3/c1-37-30(35)17-12-22-6-5-9-28(18-22)34(31(36)25-7-3-2-4-8-25)21-23-10-13-24(14-11-23)26-15-16-29-27(19-26)20-32-33-29/h5-6,9-20,25H,2-4,7-8,21H2,1H3,(H,32,33)/b17-12+ |
| InChIKey | SYQKSBGAXFFXMB-SFQUDFHCSA-N |
| XLogP | 6.53 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|