C24H25BrFNO3 — CID 140902107
methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methyl-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoate (PubChem CID 140902107) has the molecular formula C24H25BrFNO3 and a molecular weight of 474.37 g/mol. Its IUPAC name is methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methyl-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methyl-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 140902107 |
| Molecular Formula | C24H25BrFNO3 |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | methyl (E)-3-[3-[(4-bromo-2-fluorophenyl)methyl-(cyclohexanecarbonyl)amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(N(Cc2ccc(Br)cc2F)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C24H25BrFNO3/c1-30-23(28)13-10-17-6-5-9-21(14-17)27(24(29)18-7-3-2-4-8-18)16-19-11-12-20(25)15-22(19)26/h5-6,9-15,18H,2-4,7-8,16H2,1H3/b13-10+ |
| InChIKey | XRHBWTYGFPCNSP-JLHYYAGUSA-N |
| XLogP | 5.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|