C11H12O3S — CID 117322068
4-(1,3-benzoxathiol-6-yl)butanoic acid (PubChem CID 117322068) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is 4-(1,3-benzoxathiol-6-yl)butanoic acid.
| Compound Name | 4-(1,3-benzoxathiol-6-yl)butanoic acid |
|---|---|
| PubChem CID | 117322068 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 4-(1,3-benzoxathiol-6-yl)butanoic acid |
| SMILES | O=C(O)CCCc1ccc2c(c1)OCS2 |
| InChI | InChI=1S/C11H12O3S/c12-11(13)3-1-2-8-4-5-10-9(6-8)14-7-15-10/h4-6H,1-3,7H2,(H,12,13) |
| InChIKey | MHNFWSUEWBCBSQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |