C12H15F9O3S — CID 11732336
[(Z)-oct-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 11732336) has the molecular formula C12H15F9O3S and a molecular weight of 410.30 g/mol. Its IUPAC name is [(Z)-oct-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(Z)-oct-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 11732336 |
| Molecular Formula | C12H15F9O3S |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | [(Z)-oct-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCCCC/C=C\OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F9O3S/c1-2-3-4-5-6-7-8-24-25(22,23)12(20,21)10(15,16)9(13,14)11(17,18)19/h7-8H,2-6H2,1H3/b8-7- |
| InChIKey | BEOGEWGPHBJDBG-FPLPWBNLSA-N |
| XLogP | 5.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|