C13H17F9O3S — CID 11761663
[(E)-non-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 11761663) has the molecular formula C13H17F9O3S and a molecular weight of 424.33 g/mol. Its IUPAC name is [(E)-non-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(E)-non-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 11761663 |
| Molecular Formula | C13H17F9O3S |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | [(E)-non-1-enyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCCCCC/C=C/OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H17F9O3S/c1-2-3-4-5-6-7-8-9-25-26(23,24)13(21,22)11(16,17)10(14,15)12(18,19)20/h8-9H,2-7H2,1H3/b9-8+ |
| InChIKey | VZUBALFWPMOPAH-CMDGGOBGSA-N |
| XLogP | 5.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|