C12H13N5 — CID 117327028
4-(1,3-dimethylindazol-4-yl)-1H-pyrazol-5-amine (PubChem CID 117327028) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-(1,3-dimethylindazol-4-yl)-1H-pyrazol-5-amine.
| Compound Name | 4-(1,3-dimethylindazol-4-yl)-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117327028 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-(1,3-dimethylindazol-4-yl)-1H-pyrazol-5-amine |
| SMILES | Cc1nn(C)c2cccc(-c3cn[nH]c3N)c12 |
| InChI | InChI=1S/C12H13N5/c1-7-11-8(9-6-14-15-12(9)13)4-3-5-10(11)17(2)16-7/h3-6H,1-2H3,(H3,13,14,15) |
| InChIKey | WFRULNWBXORMPN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |