C11H17NS2 — CID 117327527
2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine (PubChem CID 117327527) has the molecular formula C11H17NS2 and a molecular weight of 227.40 g/mol. Its IUPAC name is 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine.
| Compound Name | 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 117327527 |
| Molecular Formula | C11H17NS2 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine |
| SMILES | CNCCc1cccc(SC)c1SC |
| InChI | InChI=1S/C11H17NS2/c1-12-8-7-9-5-4-6-10(13-2)11(9)14-3/h4-6,12H,7-8H2,1-3H3 |
| InChIKey | GMTDLQRAMGOIFI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |