About 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine
2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine (PubChem CID 117327527) has the molecular formula C11H17NS2
and a molecular weight of 227.40 g/mol. Its IUPAC name is 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine.
Molecular Properties
| Compound Name | 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine |
| PubChem CID | 117327527 |
| Molecular Formula | C11H17NS2 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine |
| SMILES | CNCCc1cccc(SC)c1SC |
| InChI | InChI=1S/C11H17NS2/c1-12-8-7-9-5-4-6-10(13-2)11(9)14-3/h4-6,12H,7-8H2,1-3H3 |
| InChIKey | GMTDLQRAMGOIFI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine?
The IUPAC name of 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine (CID 117327527) is 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine.
What is the SMILES notation for 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine?
The canonical SMILES for 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine is CNCCc1cccc(SC)c1SC.
What is the InChIKey of 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine?
The InChIKey is GMTDLQRAMGOIFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NS2/c1-12-8-7-9-5-4-6-10(13-2)11(9)14-3/h4-6,12H,7-8H2,1-3H3.
What are the key properties of 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine?
2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine has a molecular weight of 227.40 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-bis(methylsulfanyl)phenyl]-N-methylethanamine is sourced from PubChem (CID 117327527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).