C11H14OS2 — CID 117325853
1-[2,3-bis(methylsulfanyl)phenyl]propan-2-one (PubChem CID 117325853) has the molecular formula C11H14OS2 and a molecular weight of 226.37 g/mol. Its IUPAC name is 1-[2,3-bis(methylsulfanyl)phenyl]propan-2-one.
| Compound Name | 1-[2,3-bis(methylsulfanyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 117325853 |
| Molecular Formula | C11H14OS2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 1-[2,3-bis(methylsulfanyl)phenyl]propan-2-one |
| SMILES | CSc1cccc(CC(C)=O)c1SC |
| InChI | InChI=1S/C11H14OS2/c1-8(12)7-9-5-4-6-10(13-2)11(9)14-3/h4-6H,7H2,1-3H3 |
| InChIKey | ASNYZTJHNMOIOP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |