C10H12O3S2 — CID 117362892
2-[2,3-bis(methylsulfanyl)phenyl]-2-hydroxyacetic acid (PubChem CID 117362892) has the molecular formula C10H12O3S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-[2,3-bis(methylsulfanyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2,3-bis(methylsulfanyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117362892 |
| Molecular Formula | C10H12O3S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 2-[2,3-bis(methylsulfanyl)phenyl]-2-hydroxyacetic acid |
| SMILES | CSc1cccc(C(O)C(=O)O)c1SC |
| InChI | InChI=1S/C10H12O3S2/c1-14-7-5-3-4-6(9(7)15-2)8(11)10(12)13/h3-5,8,11H,1-2H3,(H,12,13) |
| InChIKey | QEPLAJFBSAXUQK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |