C12H15ClO3S — CID 118825421
2-[2-(3-chloropropyl)-3-methylsulfanylphenyl]-2-hydroxyacetic acid (PubChem CID 118825421) has the molecular formula C12H15ClO3S and a molecular weight of 274.77 g/mol. Its IUPAC name is 2-[2-(3-chloropropyl)-3-methylsulfanylphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(3-chloropropyl)-3-methylsulfanylphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118825421 |
| Molecular Formula | C12H15ClO3S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-[2-(3-chloropropyl)-3-methylsulfanylphenyl]-2-hydroxyacetic acid |
| SMILES | CSc1cccc(C(O)C(=O)O)c1CCCCl |
| InChI | InChI=1S/C12H15ClO3S/c1-17-10-6-2-4-9(11(14)12(15)16)8(10)5-3-7-13/h2,4,6,11,14H,3,5,7H2,1H3,(H,15,16) |
| InChIKey | DIFCXJJJPIBITE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|