C11H12ClIO3 — CID 134657421
2-[2-(3-chloropropyl)-3-iodophenyl]-2-hydroxyacetic acid (PubChem CID 134657421) has the molecular formula C11H12ClIO3 and a molecular weight of 354.57 g/mol. Its IUPAC name is 2-[2-(3-chloropropyl)-3-iodophenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(3-chloropropyl)-3-iodophenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134657421 |
| Molecular Formula | C11H12ClIO3 |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 2-[2-(3-chloropropyl)-3-iodophenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1cccc(I)c1CCCCl |
| InChI | InChI=1S/C11H12ClIO3/c12-6-2-4-7-8(10(14)11(15)16)3-1-5-9(7)13/h1,3,5,10,14H,2,4,6H2,(H,15,16) |
| InChIKey | DKACSDUDXCFXIS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|