About 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid
1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid (PubChem CID 174551173) has the molecular formula C14H21ClO3
and a molecular weight of 272.77 g/mol. Its IUPAC name is 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid.
Molecular Properties
| Compound Name | 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid |
| PubChem CID | 174551173 |
| Molecular Formula | C14H21ClO3 |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid |
| SMILES | CCCCCCl.Cc1ccccc1C(O)C(=O)O |
| InChI | InChI=1S/C9H10O3.C5H11Cl/c1-6-4-2-3-5-7(6)8(10)9(11)12;1-2-3-4-5-6/h2-5,8,10H,1H3,(H,11,12);2-5H2,1H3 |
| InChIKey | YYZOGMIXWMDAAE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid?
The IUPAC name of 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid (CID 174551173) is 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid.
What is the SMILES notation for 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid?
The canonical SMILES for 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid is CCCCCCl.Cc1ccccc1C(O)C(=O)O.
What is the InChIKey of 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid?
The InChIKey is YYZOGMIXWMDAAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.C5H11Cl/c1-6-4-2-3-5-7(6)8(10)9(11)12;1-2-3-4-5-6/h2-5,8,10H,1H3,(H,11,12);2-5H2,1H3.
What are the key properties of 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid?
1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid has a molecular weight of 272.77 g/mol, XLogP of 3.53, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;2-hydroxy-2-(2-methylphenyl)acetic acid is sourced from PubChem (CID 174551173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).