C12H16OS3 — CID 117434210
1-[3,4,5-tris(methylsulfanyl)phenyl]propan-2-one (PubChem CID 117434210) has the molecular formula C12H16OS3 and a molecular weight of 272.46 g/mol. Its IUPAC name is 1-[3,4,5-tris(methylsulfanyl)phenyl]propan-2-one.
| Compound Name | 1-[3,4,5-tris(methylsulfanyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 117434210 |
| Molecular Formula | C12H16OS3 |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 1-[3,4,5-tris(methylsulfanyl)phenyl]propan-2-one |
| SMILES | CSc1cc(CC(C)=O)cc(SC)c1SC |
| InChI | InChI=1S/C12H16OS3/c1-8(13)5-9-6-10(14-2)12(16-4)11(7-9)15-3/h6-7H,5H2,1-4H3 |
| InChIKey | PXHYRTZZVKOFKD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |